C30H37N5O3S — CID 66893805
5-tert-butyl-3-[3-[7-methoxy-6-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]sulfanylphenyl]-1,2-oxazole (PubChem CID 66893805) has the molecular formula C30H37N5O3S and a molecular weight of 547.73 g/mol. Its IUPAC name is 5-tert-butyl-3-[3-[7-methoxy-6-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]sulfanylphenyl]-1,2-oxazole.
| Compound Name | 5-tert-butyl-3-[3-[7-methoxy-6-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]sulfanylphenyl]-1,2-oxazole |
|---|---|
| PubChem CID | 66893805 |
| Molecular Formula | C30H37N5O3S |
| Molecular Weight | 547.73 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | 5-tert-butyl-3-[3-[7-methoxy-6-[3-(4-methylpiperazin-1-yl)propoxy]quinazolin-4-yl]sulfanylphenyl]-1,2-oxazole |
| SMILES | COc1cc2ncnc(Sc3cccc(-c4cc(C(C)(C)C)on4)c3)c2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C30H37N5O3S/c1-30(2,3)28-19-24(33-38-28)21-8-6-9-22(16-21)39-29-23-17-27(26(36-5)18-25(23)31-20-32-29)37-15-7-10-35-13-11-34(4)12-14-35/h6,8-9,16-20H,7,10-15H2,1-5H3 |
| InChIKey | ZICRWVRELMQRRK-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 76.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|