C18H21N3O3S2 — CID 66893887
N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide (PubChem CID 66893887) has the molecular formula C18H21N3O3S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide.
| Compound Name | N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 66893887 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(CN2CCCNCC2)c2occc2c1)c1cccs1 |
| InChI | InChI=1S/C18H21N3O3S2/c22-26(23,17-3-1-10-25-17)20-16-11-14-4-9-24-18(14)15(12-16)13-21-7-2-5-19-6-8-21/h1,3-4,9-12,19-20H,2,5-8,13H2 |
| InChIKey | VDEMSVAGCXKBIM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |