About N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide
N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide (PubChem CID 66893887) has the molecular formula C18H21N3O3S2
and a molecular weight of 391.52 g/mol. Its IUPAC name is N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide |
| PubChem CID | 66893887 |
| Molecular Formula | C18H21N3O3S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(CN2CCCNCC2)c2occc2c1)c1cccs1 |
| InChI | InChI=1S/C18H21N3O3S2/c22-26(23,17-3-1-10-25-17)20-16-11-14-4-9-24-18(14)15(12-16)13-21-7-2-5-19-6-8-21/h1,3-4,9-12,19-20H,2,5-8,13H2 |
| InChIKey | VDEMSVAGCXKBIM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide?
The IUPAC name of N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide (CID 66893887) is N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide.
What is the SMILES notation for N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide?
The canonical SMILES for N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide is O=S(=O)(Nc1cc(CN2CCCNCC2)c2occc2c1)c1cccs1.
What is the InChIKey of N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide?
The InChIKey is VDEMSVAGCXKBIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3O3S2/c22-26(23,17-3-1-10-25-17)20-16-11-14-4-9-24-18(14)15(12-16)13-21-7-2-5-19-6-8-21/h1,3-4,9-12,19-20H,2,5-8,13H2.
What are the key properties of N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide?
N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide has a molecular weight of 391.52 g/mol, XLogP of 3.09, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-(1,4-diazepan-1-ylmethyl)-1-benzofuran-5-yl]thiophene-2-sulfonamide is sourced from PubChem (CID 66893887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).