C20H25FN4O4S — CID 66894133
1-[3-fluoro-5-(1-propylsulfonylpyrrolidin-3-yl)oxyphenyl]-3-(6-methyl-3-pyridinyl)urea (PubChem CID 66894133) has the molecular formula C20H25FN4O4S and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[3-fluoro-5-(1-propylsulfonylpyrrolidin-3-yl)oxyphenyl]-3-(6-methyl-3-pyridinyl)urea.
| Compound Name | 1-[3-fluoro-5-(1-propylsulfonylpyrrolidin-3-yl)oxyphenyl]-3-(6-methyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 66894133 |
| Molecular Formula | C20H25FN4O4S |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[3-fluoro-5-(1-propylsulfonylpyrrolidin-3-yl)oxyphenyl]-3-(6-methyl-3-pyridinyl)urea |
| SMILES | CCCS(=O)(=O)N1CCC(Oc2cc(F)cc(NC(=O)Nc3ccc(C)nc3)c2)C1 |
| InChI | InChI=1S/C20H25FN4O4S/c1-3-8-30(27,28)25-7-6-18(13-25)29-19-10-15(21)9-17(11-19)24-20(26)23-16-5-4-14(2)22-12-16/h4-5,9-12,18H,3,6-8,13H2,1-2H3,(H2,23,24,26) |
| InChIKey | ZKGGRVSQSSDZJV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |