C22H27FN4O3 — CID 68769136
1-[2-[3-(1-acetylpiperidin-3-yl)oxy-5-fluorophenyl]ethyl]-3-(6-methyl-3-pyridinyl)urea (PubChem CID 68769136) has the molecular formula C22H27FN4O3 and a molecular weight of 414.48 g/mol. Its IUPAC name is 1-[2-[3-(1-acetylpiperidin-3-yl)oxy-5-fluorophenyl]ethyl]-3-(6-methyl-3-pyridinyl)urea.
| Compound Name | 1-[2-[3-(1-acetylpiperidin-3-yl)oxy-5-fluorophenyl]ethyl]-3-(6-methyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 68769136 |
| Molecular Formula | C22H27FN4O3 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 1-[2-[3-(1-acetylpiperidin-3-yl)oxy-5-fluorophenyl]ethyl]-3-(6-methyl-3-pyridinyl)urea |
| SMILES | CC(=O)N1CCCC(Oc2cc(F)cc(CCNC(=O)Nc3ccc(C)nc3)c2)C1 |
| InChI | InChI=1S/C22H27FN4O3/c1-15-5-6-19(13-25-15)26-22(29)24-8-7-17-10-18(23)12-21(11-17)30-20-4-3-9-27(14-20)16(2)28/h5-6,10-13,20H,3-4,7-9,14H2,1-2H3,(H2,24,26,29) |
| InChIKey | RSLNPBSHYBVNDO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |