C22H23FN4O3 — CID 87565631
1-[[3-[(3R)-1-acetylpiperidin-3-yl]oxy-5-fluorophenyl]methyl]-3-(6-ethynyl-3-pyridinyl)urea (PubChem CID 87565631) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is 1-[[3-[(3R)-1-acetylpiperidin-3-yl]oxy-5-fluorophenyl]methyl]-3-(6-ethynyl-3-pyridinyl)urea.
| Compound Name | 1-[[3-[(3R)-1-acetylpiperidin-3-yl]oxy-5-fluorophenyl]methyl]-3-(6-ethynyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 87565631 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 1-[[3-[(3R)-1-acetylpiperidin-3-yl]oxy-5-fluorophenyl]methyl]-3-(6-ethynyl-3-pyridinyl)urea |
| SMILES | C#Cc1ccc(NC(=O)NCc2cc(F)cc(O[C@@H]3CCCN(C(C)=O)C3)c2)cn1 |
| InChI | InChI=1S/C22H23FN4O3/c1-3-18-6-7-19(13-24-18)26-22(29)25-12-16-9-17(23)11-21(10-16)30-20-5-4-8-27(14-20)15(2)28/h1,6-7,9-11,13,20H,4-5,8,12,14H2,2H3,(H2,25,26,29)/t20-/m1/s1 |
| InChIKey | XWRHFKDXKBUCJS-HXUWFJFHSA-N |
| XLogP | 2.91 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|