C21H25FN4O3 — CID 68764112
1-[[3-(1-acetylpiperidin-3-yl)oxy-5-fluorophenyl]methyl]-3-(6-methyl-3-pyridinyl)urea (PubChem CID 68764112) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is 1-[[3-(1-acetylpiperidin-3-yl)oxy-5-fluorophenyl]methyl]-3-(6-methyl-3-pyridinyl)urea.
| Compound Name | 1-[[3-(1-acetylpiperidin-3-yl)oxy-5-fluorophenyl]methyl]-3-(6-methyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 68764112 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[[3-(1-acetylpiperidin-3-yl)oxy-5-fluorophenyl]methyl]-3-(6-methyl-3-pyridinyl)urea |
| SMILES | CC(=O)N1CCCC(Oc2cc(F)cc(CNC(=O)Nc3ccc(C)nc3)c2)C1 |
| InChI | InChI=1S/C21H25FN4O3/c1-14-5-6-18(12-23-14)25-21(28)24-11-16-8-17(22)10-20(9-16)29-19-4-3-7-26(13-19)15(2)27/h5-6,8-10,12,19H,3-4,7,11,13H2,1-2H3,(H2,24,25,28) |
| InChIKey | MMMBNHSXAXHMIX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |