C17H18F3N3O4 — CID 66897465
3-N-[3-(3-nitrophenyl)propyl]benzene-1,3-diamine;2,2,2-trifluoroacetic acid (PubChem CID 66897465) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is 3-N-[3-(3-nitrophenyl)propyl]benzene-1,3-diamine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-N-[3-(3-nitrophenyl)propyl]benzene-1,3-diamine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66897465 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 3-N-[3-(3-nitrophenyl)propyl]benzene-1,3-diamine;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cccc(NCCCc2cccc([N+](=O)[O-])c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H17N3O2.C2HF3O2/c16-13-6-2-7-14(11-13)17-9-3-5-12-4-1-8-15(10-12)18(19)20;3-2(4,5)1(6)7/h1-2,4,6-8,10-11,17H,3,5,9,16H2;(H,6,7) |
| InChIKey | WWFKQRKFLGRNAD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|