C19H25Cl2N5O — CID 66897535
1-[3-amino-4-oxo-4-(4-phenylpiperazin-1-yl)butyl]pyrrole-2-carbonitrile;dihydrochloride (PubChem CID 66897535) has the molecular formula C19H25Cl2N5O and a molecular weight of 410.35 g/mol. Its IUPAC name is 1-[3-amino-4-oxo-4-(4-phenylpiperazin-1-yl)butyl]pyrrole-2-carbonitrile;dihydrochloride.
| Compound Name | 1-[3-amino-4-oxo-4-(4-phenylpiperazin-1-yl)butyl]pyrrole-2-carbonitrile;dihydrochloride |
|---|---|
| PubChem CID | 66897535 |
| Molecular Formula | C19H25Cl2N5O |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-[3-amino-4-oxo-4-(4-phenylpiperazin-1-yl)butyl]pyrrole-2-carbonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1cccn1CCC(N)C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N5O.2ClH/c20-15-17-7-4-9-22(17)10-8-18(21)19(25)24-13-11-23(12-14-24)16-5-2-1-3-6-16;;/h1-7,9,18H,8,10-14,21H2;2*1H |
| InChIKey | MCNFDDRVBWHJHT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 78.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |