C18H26N4O — CID 66900244
1-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-amino-4-oxobutyl]pyrrole-2-carbonitrile (PubChem CID 66900244) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-amino-4-oxobutyl]pyrrole-2-carbonitrile.
| Compound Name | 1-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-amino-4-oxobutyl]pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 66900244 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-[4-[(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl]-3-amino-4-oxobutyl]pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1CCC(N)C(=O)N1CC[C@H]2CCCC[C@@H]2C1 |
| InChI | InChI=1S/C18H26N4O/c19-12-16-6-3-9-21(16)11-8-17(20)18(23)22-10-7-14-4-1-2-5-15(14)13-22/h3,6,9,14-15,17H,1-2,4-5,7-8,10-11,13,20H2/t14-,15-,17?/m1/s1 |
| InChIKey | WJTUSVOYINSVHH-BLBXNVQISA-N |
| XLogP | 2.12 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |