C18H23BrO5 — CID 66899641
ethyl (Z)-4-bromo-3-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenoxy]but-2-enoate (PubChem CID 66899641) has the molecular formula C18H23BrO5 and a molecular weight of 399.28 g/mol. Its IUPAC name is ethyl (Z)-4-bromo-3-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenoxy]but-2-enoate.
| Compound Name | ethyl (Z)-4-bromo-3-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenoxy]but-2-enoate |
|---|---|
| PubChem CID | 66899641 |
| Molecular Formula | C18H23BrO5 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | ethyl (Z)-4-bromo-3-[4-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]phenoxy]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/CBr)Oc1ccc(C[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C18H23BrO5/c1-4-21-17(20)10-15(11-19)23-14-7-5-13(6-8-14)9-16-12-22-18(2,3)24-16/h5-8,10,16H,4,9,11-12H2,1-3H3/b15-10-/t16-/m0/s1 |
| InChIKey | FMFZKIWLHVGHRD-IZNAZMGOSA-N |
| XLogP | 3.60 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|