C26H44N6O — CID 66903713
1-[4-[3-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]azepan-1-yl]piperidin-1-yl]pentan-1-one (PubChem CID 66903713) has the molecular formula C26H44N6O and a molecular weight of 456.68 g/mol. Its IUPAC name is 1-[4-[3-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]azepan-1-yl]piperidin-1-yl]pentan-1-one.
| Compound Name | 1-[4-[3-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]azepan-1-yl]piperidin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 66903713 |
| Molecular Formula | C26H44N6O |
| Molecular Weight | 456.68 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 1-[4-[3-[[4-(azepan-1-yl)pyrimidin-2-yl]amino]azepan-1-yl]piperidin-1-yl]pentan-1-one |
| SMILES | CCCCC(=O)N1CCC(N2CCCCC(Nc3nccc(N4CCCCCC4)n3)C2)CC1 |
| InChI | InChI=1S/C26H44N6O/c1-2-3-11-25(33)31-19-13-23(14-20-31)32-18-9-6-10-22(21-32)28-26-27-15-12-24(29-26)30-16-7-4-5-8-17-30/h12,15,22-23H,2-11,13-14,16-21H2,1H3,(H,27,28,29) |
| InChIKey | IKRSKQKRGXRBEI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |