About (1,3-dichloroindol-2-yl) octanoate
(1,3-dichloroindol-2-yl) octanoate (PubChem CID 66912478) has the molecular formula C16H19Cl2NO2
and a molecular weight of 328.24 g/mol. Its IUPAC name is (1,3-dichloroindol-2-yl) octanoate.
Molecular Properties
| Compound Name | (1,3-dichloroindol-2-yl) octanoate |
| PubChem CID | 66912478 |
| Molecular Formula | C16H19Cl2NO2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | (1,3-dichloroindol-2-yl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1c(Cl)c2ccccc2n1Cl |
| InChI | InChI=1S/C16H19Cl2NO2/c1-2-3-4-5-6-11-14(20)21-16-15(17)12-9-7-8-10-13(12)19(16)18/h7-10H,2-6,11H2,1H3 |
| InChIKey | PIOMIQMDQREBAP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dichloroindol-2-yl) octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dichloroindol-2-yl) octanoate?
The IUPAC name of (1,3-dichloroindol-2-yl) octanoate (CID 66912478) is (1,3-dichloroindol-2-yl) octanoate.
What is the SMILES notation for (1,3-dichloroindol-2-yl) octanoate?
The canonical SMILES for (1,3-dichloroindol-2-yl) octanoate is CCCCCCCC(=O)Oc1c(Cl)c2ccccc2n1Cl.
What is the InChIKey of (1,3-dichloroindol-2-yl) octanoate?
The InChIKey is PIOMIQMDQREBAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19Cl2NO2/c1-2-3-4-5-6-11-14(20)21-16-15(17)12-9-7-8-10-13(12)19(16)18/h7-10H,2-6,11H2,1H3.
What are the key properties of (1,3-dichloroindol-2-yl) octanoate?
(1,3-dichloroindol-2-yl) octanoate has a molecular weight of 328.24 g/mol, XLogP of 5.56, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dichloroindol-2-yl) octanoate is sourced from PubChem (CID 66912478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).