C18H25NO3 — CID 66915735
2-(6-methoxy-1-benzofuran-2-yl)-N-(5-methylhexan-2-yl)acetamide (PubChem CID 66915735) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-(6-methoxy-1-benzofuran-2-yl)-N-(5-methylhexan-2-yl)acetamide.
| Compound Name | 2-(6-methoxy-1-benzofuran-2-yl)-N-(5-methylhexan-2-yl)acetamide |
|---|---|
| PubChem CID | 66915735 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-(6-methoxy-1-benzofuran-2-yl)-N-(5-methylhexan-2-yl)acetamide |
| SMILES | COc1ccc2cc(CC(=O)NC(C)CCC(C)C)oc2c1 |
| InChI | InChI=1S/C18H25NO3/c1-12(2)5-6-13(3)19-18(20)11-16-9-14-7-8-15(21-4)10-17(14)22-16/h7-10,12-13H,5-6,11H2,1-4H3,(H,19,20) |
| InChIKey | MKSIYCASMUEVND-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |