C13H14F3NO4 — CID 66916961
3-[[4,5-diethyl-3-(trifluoromethyl)-2-pyridinyl]oxy]-3-oxopropanoic acid (PubChem CID 66916961) has the molecular formula C13H14F3NO4 and a molecular weight of 305.25 g/mol. Its IUPAC name is 3-[[4,5-diethyl-3-(trifluoromethyl)-2-pyridinyl]oxy]-3-oxopropanoic acid.
| Compound Name | 3-[[4,5-diethyl-3-(trifluoromethyl)-2-pyridinyl]oxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 66916961 |
| Molecular Formula | C13H14F3NO4 |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-[[4,5-diethyl-3-(trifluoromethyl)-2-pyridinyl]oxy]-3-oxopropanoic acid |
| SMILES | CCc1cnc(OC(=O)CC(=O)O)c(C(F)(F)F)c1CC |
| InChI | InChI=1S/C13H14F3NO4/c1-3-7-6-17-12(21-10(20)5-9(18)19)11(8(7)4-2)13(14,15)16/h6H,3-5H2,1-2H3,(H,18,19) |
| InChIKey | FSVZZRSGHMHYQO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|