C24H24ClNO5S — CID 66918306
methyl 4-[[4-chloro-2-[(2-propan-2-ylphenyl)sulfonylamino]phenoxy]methyl]benzoate (PubChem CID 66918306) has the molecular formula C24H24ClNO5S and a molecular weight of 473.98 g/mol. Its IUPAC name is methyl 4-[[4-chloro-2-[(2-propan-2-ylphenyl)sulfonylamino]phenoxy]methyl]benzoate.
| Compound Name | methyl 4-[[4-chloro-2-[(2-propan-2-ylphenyl)sulfonylamino]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 66918306 |
| Molecular Formula | C24H24ClNO5S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | methyl 4-[[4-chloro-2-[(2-propan-2-ylphenyl)sulfonylamino]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2ccc(Cl)cc2NS(=O)(=O)c2ccccc2C(C)C)cc1 |
| InChI | InChI=1S/C24H24ClNO5S/c1-16(2)20-6-4-5-7-23(20)32(28,29)26-21-14-19(25)12-13-22(21)31-15-17-8-10-18(11-9-17)24(27)30-3/h4-14,16,26H,15H2,1-3H3 |
| InChIKey | QKGBMJFGKGGCAG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |