C37H32N4O6 — CID 66926539
methyl 3-[4-[[N-[(4-cyanophenyl)methyl]-2-methyl-3-nitroanilino]methyl]phenoxy]-5-(2-pyridin-3-ylethoxy)benzoate (PubChem CID 66926539) has the molecular formula C37H32N4O6 and a molecular weight of 628.69 g/mol. Its IUPAC name is methyl 3-[4-[[N-[(4-cyanophenyl)methyl]-2-methyl-3-nitroanilino]methyl]phenoxy]-5-(2-pyridin-3-ylethoxy)benzoate.
| Compound Name | methyl 3-[4-[[N-[(4-cyanophenyl)methyl]-2-methyl-3-nitroanilino]methyl]phenoxy]-5-(2-pyridin-3-ylethoxy)benzoate |
|---|---|
| PubChem CID | 66926539 |
| Molecular Formula | C37H32N4O6 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.23 |
| IUPAC Name | methyl 3-[4-[[N-[(4-cyanophenyl)methyl]-2-methyl-3-nitroanilino]methyl]phenoxy]-5-(2-pyridin-3-ylethoxy)benzoate |
| SMILES | COC(=O)c1cc(OCCc2cccnc2)cc(Oc2ccc(CN(Cc3ccc(C#N)cc3)c3cccc([N+](=O)[O-])c3C)cc2)c1 |
| InChI | InChI=1S/C37H32N4O6/c1-26-35(6-3-7-36(26)41(43)44)40(24-29-10-8-27(22-38)9-11-29)25-30-12-14-32(15-13-30)47-34-20-31(37(42)45-2)19-33(21-34)46-18-16-28-5-4-17-39-23-28/h3-15,17,19-21,23H,16,18,24-25H2,1-2H3 |
| InChIKey | FCCVOIPXNIMOSX-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 127.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|