C27H21BrF2N2O3 — CID 18511981
N-[[4-(4-bromophenoxy)phenyl]methyl]-N-[(2,4-difluorophenyl)methyl]-2-methyl-3-nitroaniline (PubChem CID 18511981) has the molecular formula C27H21BrF2N2O3 and a molecular weight of 539.38 g/mol. Its IUPAC name is N-[[4-(4-bromophenoxy)phenyl]methyl]-N-[(2,4-difluorophenyl)methyl]-2-methyl-3-nitroaniline.
| Compound Name | N-[[4-(4-bromophenoxy)phenyl]methyl]-N-[(2,4-difluorophenyl)methyl]-2-methyl-3-nitroaniline |
|---|---|
| PubChem CID | 18511981 |
| Molecular Formula | C27H21BrF2N2O3 |
| Molecular Weight | 539.38 g/mol |
| Exact Mass | 538.07 |
| IUPAC Name | N-[[4-(4-bromophenoxy)phenyl]methyl]-N-[(2,4-difluorophenyl)methyl]-2-methyl-3-nitroaniline |
| SMILES | Cc1c(N(Cc2ccc(Oc3ccc(Br)cc3)cc2)Cc2ccc(F)cc2F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H21BrF2N2O3/c1-18-26(3-2-4-27(18)32(33)34)31(17-20-7-10-22(29)15-25(20)30)16-19-5-11-23(12-6-19)35-24-13-8-21(28)9-14-24/h2-15H,16-17H2,1H3 |
| InChIKey | CBDFTCAALQKZPD-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.38 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|