C30H27BrN2O4 — CID 18512368
N-benzyl-N-[[4-(4-bromo-3-prop-2-enoxyphenoxy)phenyl]methyl]-2-methyl-3-nitroaniline (PubChem CID 18512368) has the molecular formula C30H27BrN2O4 and a molecular weight of 559.46 g/mol. Its IUPAC name is N-benzyl-N-[[4-(4-bromo-3-prop-2-enoxyphenoxy)phenyl]methyl]-2-methyl-3-nitroaniline.
| Compound Name | N-benzyl-N-[[4-(4-bromo-3-prop-2-enoxyphenoxy)phenyl]methyl]-2-methyl-3-nitroaniline |
|---|---|
| PubChem CID | 18512368 |
| Molecular Formula | C30H27BrN2O4 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N-benzyl-N-[[4-(4-bromo-3-prop-2-enoxyphenoxy)phenyl]methyl]-2-methyl-3-nitroaniline |
| SMILES | C=CCOc1cc(Oc2ccc(CN(Cc3ccccc3)c3cccc([N+](=O)[O-])c3C)cc2)ccc1Br |
| InChI | InChI=1S/C30H27BrN2O4/c1-3-18-36-30-19-26(16-17-27(30)31)37-25-14-12-24(13-15-25)21-32(20-23-8-5-4-6-9-23)28-10-7-11-29(22(28)2)33(34)35/h3-17,19H,1,18,20-21H2,2H3 |
| InChIKey | XZZWJJWQFXDYSW-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|