C31H27BrF2N2O6 — CID 86759034
ethyl 2-[2-bromo-5-[4-[[N-[(2,4-difluorophenyl)methyl]-2-methyl-3-nitroanilino]methyl]phenoxy]phenoxy]acetate (PubChem CID 86759034) has the molecular formula C31H27BrF2N2O6 and a molecular weight of 641.47 g/mol. Its IUPAC name is ethyl 2-[2-bromo-5-[4-[[N-[(2,4-difluorophenyl)methyl]-2-methyl-3-nitroanilino]methyl]phenoxy]phenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-5-[4-[[N-[(2,4-difluorophenyl)methyl]-2-methyl-3-nitroanilino]methyl]phenoxy]phenoxy]acetate |
|---|---|
| PubChem CID | 86759034 |
| Molecular Formula | C31H27BrF2N2O6 |
| Molecular Weight | 641.47 g/mol |
| Exact Mass | 640.10 |
| IUPAC Name | ethyl 2-[2-bromo-5-[4-[[N-[(2,4-difluorophenyl)methyl]-2-methyl-3-nitroanilino]methyl]phenoxy]phenoxy]acetate |
| SMILES | CCOC(=O)COc1cc(Oc2ccc(CN(Cc3ccc(F)cc3F)c3cccc([N+](=O)[O-])c3C)cc2)ccc1Br |
| InChI | InChI=1S/C31H27BrF2N2O6/c1-3-40-31(37)19-41-30-16-25(13-14-26(30)32)42-24-11-7-21(8-12-24)17-35(18-22-9-10-23(33)15-27(22)34)28-5-4-6-29(20(28)2)36(38)39/h4-16H,3,17-19H2,1-2H3 |
| InChIKey | MKMCTDCBGBKNQI-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.47 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|