C22H22BrFN2O2S — CID 18512050
N-[3-[benzyl-[(4-bromo-2-fluorophenyl)methyl]amino]-2-methylphenyl]methanesulfonamide (PubChem CID 18512050) has the molecular formula C22H22BrFN2O2S and a molecular weight of 477.40 g/mol. Its IUPAC name is N-[3-[benzyl-[(4-bromo-2-fluorophenyl)methyl]amino]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[3-[benzyl-[(4-bromo-2-fluorophenyl)methyl]amino]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18512050 |
| Molecular Formula | C22H22BrFN2O2S |
| Molecular Weight | 477.40 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-[3-[benzyl-[(4-bromo-2-fluorophenyl)methyl]amino]-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccccc1)Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C22H22BrFN2O2S/c1-16-21(25-29(2,27)28)9-6-10-22(16)26(14-17-7-4-3-5-8-17)15-18-11-12-19(23)13-20(18)24/h3-13,25H,14-15H2,1-2H3 |
| InChIKey | KXLAMCKGGFEEKD-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.40 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |