C34H37N3O7S — CID 18512072
2-[4-[3-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenoxy]butanoylamino]acetic acid (PubChem CID 18512072) has the molecular formula C34H37N3O7S and a molecular weight of 631.75 g/mol. Its IUPAC name is 2-[4-[3-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenoxy]butanoylamino]acetic acid.
| Compound Name | 2-[4-[3-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenoxy]butanoylamino]acetic acid |
|---|---|
| PubChem CID | 18512072 |
| Molecular Formula | C34H37N3O7S |
| Molecular Weight | 631.75 g/mol |
| Exact Mass | 631.24 |
| IUPAC Name | 2-[4-[3-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenoxy]butanoylamino]acetic acid |
| SMILES | Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccccc1)Cc1ccc(Oc2cccc(OCCCC(=O)NCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C34H37N3O7S/c1-25-31(36-45(2,41)42)13-7-14-32(25)37(23-26-9-4-3-5-10-26)24-27-16-18-28(19-17-27)44-30-12-6-11-29(21-30)43-20-8-15-33(38)35-22-34(39)40/h3-7,9-14,16-19,21,36H,8,15,20,22-24H2,1-2H3,(H,35,38)(H,39,40) |
| InChIKey | GWONBVQQDPXRJG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.75 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|