C30H32N2O5S — CID 18512043
N-[3-[benzyl-[[4-[4-(methoxymethoxy)phenoxy]phenyl]methyl]amino]-2-methylphenyl]methanesulfonamide (PubChem CID 18512043) has the molecular formula C30H32N2O5S and a molecular weight of 532.66 g/mol. Its IUPAC name is N-[3-[benzyl-[[4-[4-(methoxymethoxy)phenoxy]phenyl]methyl]amino]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[3-[benzyl-[[4-[4-(methoxymethoxy)phenoxy]phenyl]methyl]amino]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18512043 |
| Molecular Formula | C30H32N2O5S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-[3-[benzyl-[[4-[4-(methoxymethoxy)phenoxy]phenyl]methyl]amino]-2-methylphenyl]methanesulfonamide |
| SMILES | COCOc1ccc(Oc2ccc(CN(Cc3ccccc3)c3cccc(NS(C)(=O)=O)c3C)cc2)cc1 |
| InChI | InChI=1S/C30H32N2O5S/c1-23-29(31-38(3,33)34)10-7-11-30(23)32(20-24-8-5-4-6-9-24)21-25-12-14-27(15-13-25)37-28-18-16-26(17-19-28)36-22-35-2/h4-19,31H,20-22H2,1-3H3 |
| InChIKey | GYBMJJBDLJJCBV-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|