C31H33BrN2O4S — CID 18512211
N-[3-[benzyl-[[4-[3-(3-bromopropoxy)phenoxy]phenyl]methyl]amino]-2-methylphenyl]methanesulfonamide (PubChem CID 18512211) has the molecular formula C31H33BrN2O4S and a molecular weight of 609.59 g/mol. Its IUPAC name is N-[3-[benzyl-[[4-[3-(3-bromopropoxy)phenoxy]phenyl]methyl]amino]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[3-[benzyl-[[4-[3-(3-bromopropoxy)phenoxy]phenyl]methyl]amino]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 18512211 |
| Molecular Formula | C31H33BrN2O4S |
| Molecular Weight | 609.59 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | N-[3-[benzyl-[[4-[3-(3-bromopropoxy)phenoxy]phenyl]methyl]amino]-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccccc1)Cc1ccc(Oc2cccc(OCCCBr)c2)cc1 |
| InChI | InChI=1S/C31H33BrN2O4S/c1-24-30(33-39(2,35)36)13-7-14-31(24)34(22-25-9-4-3-5-10-25)23-26-15-17-27(18-16-26)38-29-12-6-11-28(21-29)37-20-8-19-32/h3-7,9-18,21,33H,8,19-20,22-23H2,1-2H3 |
| InChIKey | NNSQTTNZXYAHGJ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.59 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|