C35H39N3O7S — CID 18512228
2-[5-[3-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenoxy]pentanoylamino]acetic acid (PubChem CID 18512228) has the molecular formula C35H39N3O7S and a molecular weight of 645.78 g/mol. Its IUPAC name is 2-[5-[3-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenoxy]pentanoylamino]acetic acid.
| Compound Name | 2-[5-[3-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenoxy]pentanoylamino]acetic acid |
|---|---|
| PubChem CID | 18512228 |
| Molecular Formula | C35H39N3O7S |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.25 |
| IUPAC Name | 2-[5-[3-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenoxy]pentanoylamino]acetic acid |
| SMILES | Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccccc1)Cc1ccc(Oc2cccc(OCCCCC(=O)NCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C35H39N3O7S/c1-26-32(37-46(2,42)43)14-9-15-33(26)38(24-27-10-4-3-5-11-27)25-28-17-19-29(20-18-28)45-31-13-8-12-30(22-31)44-21-7-6-16-34(39)36-23-35(40)41/h3-5,8-15,17-20,22,37H,6-7,16,21,23-25H2,1-2H3,(H,36,39)(H,40,41) |
| InChIKey | NZWZEBQGUFRCEY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|