C37H45N3O5S — CID 18512319
3-[4-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenyl]-N-(6-hydroxyhexyl)propanamide (PubChem CID 18512319) has the molecular formula C37H45N3O5S and a molecular weight of 643.85 g/mol. Its IUPAC name is 3-[4-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenyl]-N-(6-hydroxyhexyl)propanamide.
| Compound Name | 3-[4-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenyl]-N-(6-hydroxyhexyl)propanamide |
|---|---|
| PubChem CID | 18512319 |
| Molecular Formula | C37H45N3O5S |
| Molecular Weight | 643.85 g/mol |
| Exact Mass | 643.31 |
| IUPAC Name | 3-[4-[4-[[N-benzyl-3-(methanesulfonamido)-2-methylanilino]methyl]phenoxy]phenyl]-N-(6-hydroxyhexyl)propanamide |
| SMILES | Cc1c(NS(C)(=O)=O)cccc1N(Cc1ccccc1)Cc1ccc(Oc2ccc(CCC(=O)NCCCCCCO)cc2)cc1 |
| InChI | InChI=1S/C37H45N3O5S/c1-29-35(39-46(2,43)44)13-10-14-36(29)40(27-31-11-6-5-7-12-31)28-32-17-22-34(23-18-32)45-33-20-15-30(16-21-33)19-24-37(42)38-25-8-3-4-9-26-41/h5-7,10-18,20-23,39,41H,3-4,8-9,19,24-28H2,1-2H3,(H,38,42) |
| InChIKey | NVUBESPQFJTVSX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.85 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|