C14H9N3O2S2 — CID 66927458
3,4-bis(pyridin-2-ylsulfanyl)pyrrole-2,5-dione (PubChem CID 66927458) has the molecular formula C14H9N3O2S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 3,4-bis(pyridin-2-ylsulfanyl)pyrrole-2,5-dione.
| Compound Name | 3,4-bis(pyridin-2-ylsulfanyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 66927458 |
| Molecular Formula | C14H9N3O2S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 3,4-bis(pyridin-2-ylsulfanyl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(Sc2ccccn2)=C1Sc1ccccn1 |
| InChI | InChI=1S/C14H9N3O2S2/c18-13-11(20-9-5-1-3-7-15-9)12(14(19)17-13)21-10-6-2-4-8-16-10/h1-8H,(H,17,18,19) |
| InChIKey | XYVKDZSWEQHHJQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|