C8H6N2S2 — CID 15637338
2-pyridin-2-ylsulfanyl-1,3-thiazole (PubChem CID 15637338) has the molecular formula C8H6N2S2 and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-pyridin-2-ylsulfanyl-1,3-thiazole.
| Compound Name | 2-pyridin-2-ylsulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 15637338 |
| Molecular Formula | C8H6N2S2 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | 2-pyridin-2-ylsulfanyl-1,3-thiazole |
| SMILES | c1ccc(Sc2nccs2)nc1 |
| InChI | InChI=1S/C8H6N2S2/c1-2-4-9-7(3-1)12-8-10-5-6-11-8/h1-6H |
| InChIKey | FVBVZXCORWDPJH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|