C37H48N4O4S — CID 66936414
[1-[9-[2-(4-methoxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 66936414) has the molecular formula C37H48N4O4S and a molecular weight of 644.88 g/mol. Its IUPAC name is [1-[9-[2-(4-methoxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[9-[2-(4-methoxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 66936414 |
| Molecular Formula | C37H48N4O4S |
| Molecular Weight | 644.88 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | [1-[9-[2-(4-methoxy-2-oxo-3H-1,3-benzothiazol-7-yl)ethylamino]nonyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | COc1ccc(CCNCCCCCCCCCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)c2sc(=O)[nH]c12 |
| InChI | InChI=1S/C37H48N4O4S/c1-44-33-19-18-29(35-34(33)40-37(43)46-35)20-24-38-23-12-5-3-2-4-6-13-25-41-26-21-30(22-27-41)45-36(42)39-32-17-11-10-16-31(32)28-14-8-7-9-15-28/h7-11,14-19,30,38H,2-6,12-13,20-27H2,1H3,(H,39,42)(H,40,43) |
| InChIKey | NODCXNSGLLTVGX-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.88 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|