C21H25NO — CID 66937152
trans-(2R,4R)-4-(dibenzylamino)-2-methylcyclohexan-1-one (PubChem CID 66937152) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is trans-(2R,4R)-4-(dibenzylamino)-2-methylcyclohexan-1-one.
| Compound Name | trans-(2R,4R)-4-(dibenzylamino)-2-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 66937152 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | trans-(2R,4R)-4-(dibenzylamino)-2-methylcyclohexan-1-one |
| SMILES | C[C@@H]1C[C@H](N(Cc2ccccc2)Cc2ccccc2)CCC1=O |
| InChI | InChI=1S/C21H25NO/c1-17-14-20(12-13-21(17)23)22(15-18-8-4-2-5-9-18)16-19-10-6-3-7-11-19/h2-11,17,20H,12-16H2,1H3/t17-,20-/m1/s1 |
| InChIKey | JMQHRTZGFHBYOT-YLJYHZDGSA-N |
| XLogP | 4.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |