C23H42O4 — CID 66938090
dihexyl 3-ethyl-6-methylcyclohexane-1,2-dicarboxylate (PubChem CID 66938090) has the molecular formula C23H42O4 and a molecular weight of 382.59 g/mol. Its IUPAC name is dihexyl 3-ethyl-6-methylcyclohexane-1,2-dicarboxylate.
| Compound Name | dihexyl 3-ethyl-6-methylcyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66938090 |
| Molecular Formula | C23H42O4 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | dihexyl 3-ethyl-6-methylcyclohexane-1,2-dicarboxylate |
| SMILES | CCCCCCOC(=O)C1C(C)CCC(CC)C1C(=O)OCCCCCC |
| InChI | InChI=1S/C23H42O4/c1-5-8-10-12-16-26-22(24)20-18(4)14-15-19(7-3)21(20)23(25)27-17-13-11-9-6-2/h18-21H,5-17H2,1-4H3 |
| InChIKey | YSSWWNBRVPUDAW-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|