C31H26ClN7O3 — CID 66938789
methyl N-[4-[2-[(1S)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-2-phenylethyl]-4-pyridinyl]phenyl]carbamate (PubChem CID 66938789) has the molecular formula C31H26ClN7O3 and a molecular weight of 580.05 g/mol. Its IUPAC name is methyl N-[4-[2-[(1S)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-2-phenylethyl]-4-pyridinyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[2-[(1S)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-2-phenylethyl]-4-pyridinyl]phenyl]carbamate |
|---|---|
| PubChem CID | 66938789 |
| Molecular Formula | C31H26ClN7O3 |
| Molecular Weight | 580.05 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | methyl N-[4-[2-[(1S)-1-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-2-phenylethyl]-4-pyridinyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(-c2ccnc([C@H](Cc3ccccc3)NC(=O)C=Cc3cc(Cl)ccc3-n3cnnn3)c2)cc1 |
| InChI | InChI=1S/C31H26ClN7O3/c1-42-31(41)35-26-11-7-22(8-12-26)23-15-16-33-27(19-23)28(17-21-5-3-2-4-6-21)36-30(40)14-9-24-18-25(32)10-13-29(24)39-20-34-37-38-39/h2-16,18-20,28H,17H2,1H3,(H,35,41)(H,36,40)/t28-/m0/s1 |
| InChIKey | ZBUQQUJRHVSUJI-NDEPHWFRSA-N |
| XLogP | 5.67 |
| TPSA | 123.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.05 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|