C31H47NO11 — CID 66944971
(2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-5-cyclohexyloxycarbonyloxy-4-methylpentanoic acid (PubChem CID 66944971) has the molecular formula C31H47NO11 and a molecular weight of 609.71 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-5-cyclohexyloxycarbonyloxy-4-methylpentanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-5-cyclohexyloxycarbonyloxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 66944971 |
| Molecular Formula | C31H47NO11 |
| Molecular Weight | 609.71 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(pentoxycarbonyloxy)phenyl]-5-cyclohexyloxycarbonyloxy-4-methylpentanoic acid |
| SMILES | CCCCCOC(=O)Oc1ccc(C(C(C)COC(=O)OC2CCCCC2)[C@H](N)C(=O)O)cc1OC(=O)OCCCCC |
| InChI | InChI=1S/C31H47NO11/c1-4-6-11-17-38-29(35)42-24-16-15-22(19-25(24)43-30(36)39-18-12-7-5-2)26(27(32)28(33)34)21(3)20-40-31(37)41-23-13-9-8-10-14-23/h15-16,19,21,23,26-27H,4-14,17-18,20,32H2,1-3H3,(H,33,34)/t21?,26?,27-/m0/s1 |
| InChIKey | VGYRMNJPLVWPSQ-OFHXQBPLSA-N |
| XLogP | 6.72 |
| TPSA | 169.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.71 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|