C31H41NO9 — CID 66945506
[4-[(2S)-2-amino-2-methoxycarbonyl-4-phenoxycarbonyloxybutyl]-2-(2,2-dimethylbutanoyloxy)phenyl] 2,2-dimethylbutanoate (PubChem CID 66945506) has the molecular formula C31H41NO9 and a molecular weight of 571.67 g/mol. Its IUPAC name is [4-[(2S)-2-amino-2-methoxycarbonyl-4-phenoxycarbonyloxybutyl]-2-(2,2-dimethylbutanoyloxy)phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[(2S)-2-amino-2-methoxycarbonyl-4-phenoxycarbonyloxybutyl]-2-(2,2-dimethylbutanoyloxy)phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 66945506 |
| Molecular Formula | C31H41NO9 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | [4-[(2S)-2-amino-2-methoxycarbonyl-4-phenoxycarbonyloxybutyl]-2-(2,2-dimethylbutanoyloxy)phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C[C@](N)(CCOC(=O)Oc2ccccc2)C(=O)OC)cc1OC(=O)C(C)(C)CC |
| InChI | InChI=1S/C31H41NO9/c1-8-29(3,4)25(33)40-23-16-15-21(19-24(23)41-26(34)30(5,6)9-2)20-31(32,27(35)37-7)17-18-38-28(36)39-22-13-11-10-12-14-22/h10-16,19H,8-9,17-18,20,32H2,1-7H3/t31-/m1/s1 |
| InChIKey | GIGPVYVNYSKWIL-WJOKGBTCSA-N |
| XLogP | 5.39 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|