C27H41NO8 — CID 66950533
(2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)hexanoic acid (PubChem CID 66950533) has the molecular formula C27H41NO8 and a molecular weight of 507.62 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)hexanoic acid.
| Compound Name | (2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)hexanoic acid |
|---|---|
| PubChem CID | 66950533 |
| Molecular Formula | C27H41NO8 |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis(2-methylbutanoyloxy)phenyl]-5-(2,2-dimethylpropanoyloxy)hexanoic acid |
| SMILES | CCC(C)C(=O)Oc1ccc(C(CC(C)OC(=O)C(C)(C)C)[C@H](N)C(=O)O)cc1OC(=O)C(C)CC |
| InChI | InChI=1S/C27H41NO8/c1-9-15(3)24(31)35-20-12-11-18(14-21(20)36-25(32)16(4)10-2)19(22(28)23(29)30)13-17(5)34-26(33)27(6,7)8/h11-12,14-17,19,22H,9-10,13,28H2,1-8H3,(H,29,30)/t15?,16?,17?,19?,22-/m0/s1 |
| InChIKey | VVQVBQOBHUUFSV-APGULLGXSA-N |
| XLogP | 4.45 |
| TPSA | 142.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|