C18H24N2O3 — CID 66955120
ethyl 2-[1-[(2R)-2-(4-cyanophenyl)-2-hydroxyethyl]piperidin-3-yl]acetate (PubChem CID 66955120) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl 2-[1-[(2R)-2-(4-cyanophenyl)-2-hydroxyethyl]piperidin-3-yl]acetate.
| Compound Name | ethyl 2-[1-[(2R)-2-(4-cyanophenyl)-2-hydroxyethyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 66955120 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | ethyl 2-[1-[(2R)-2-(4-cyanophenyl)-2-hydroxyethyl]piperidin-3-yl]acetate |
| SMILES | CCOC(=O)CC1CCCN(C[C@H](O)c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C18H24N2O3/c1-2-23-18(22)10-15-4-3-9-20(12-15)13-17(21)16-7-5-14(11-19)6-8-16/h5-8,15,17,21H,2-4,9-10,12-13H2,1H3/t15?,17-/m0/s1 |
| InChIKey | VRAGLHNRJHPZCV-LWKPJOBUSA-N |
| XLogP | 2.26 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |