C24H38N2O3Si — CID 66955526
ethyl 2-[(3R)-1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-cyanophenyl)ethyl]piperidin-3-yl]acetate (PubChem CID 66955526) has the molecular formula C24H38N2O3Si and a molecular weight of 430.67 g/mol. Its IUPAC name is ethyl 2-[(3R)-1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-cyanophenyl)ethyl]piperidin-3-yl]acetate.
| Compound Name | ethyl 2-[(3R)-1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-cyanophenyl)ethyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 66955526 |
| Molecular Formula | C24H38N2O3Si |
| Molecular Weight | 430.67 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | ethyl 2-[(3R)-1-[(2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-(4-cyanophenyl)ethyl]piperidin-3-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCCN(C[C@H](O[Si](C)(C)C(C)(C)C)c2ccc(C#N)cc2)C1 |
| InChI | InChI=1S/C24H38N2O3Si/c1-7-28-23(27)15-20-9-8-14-26(17-20)18-22(29-30(5,6)24(2,3)4)21-12-10-19(16-25)11-13-21/h10-13,20,22H,7-9,14-15,17-18H2,1-6H3/t20-,22+/m1/s1 |
| InChIKey | YIPJLNGQPCQDAC-IRLDBZIGSA-N |
| XLogP | 5.29 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|