C24H26N2O2S — CID 66955966
methyl 2-[4-methyl-6-(4-methylphenyl)-2-phenylsulfanylpyrimidin-5-yl]pentanoate (PubChem CID 66955966) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is methyl 2-[4-methyl-6-(4-methylphenyl)-2-phenylsulfanylpyrimidin-5-yl]pentanoate.
| Compound Name | methyl 2-[4-methyl-6-(4-methylphenyl)-2-phenylsulfanylpyrimidin-5-yl]pentanoate |
|---|---|
| PubChem CID | 66955966 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | methyl 2-[4-methyl-6-(4-methylphenyl)-2-phenylsulfanylpyrimidin-5-yl]pentanoate |
| SMILES | CCCC(C(=O)OC)c1c(C)nc(Sc2ccccc2)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H26N2O2S/c1-5-9-20(23(27)28-4)21-17(3)25-24(29-19-10-7-6-8-11-19)26-22(21)18-14-12-16(2)13-15-18/h6-8,10-15,20H,5,9H2,1-4H3 |
| InChIKey | XBEIBBYXTYZSET-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |