C24H26N2O2 — CID 50997511
2-[4-methyl-6-phenyl-2-(2-phenylethyl)pyrimidin-5-yl]pentanoic acid (PubChem CID 50997511) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2-[4-methyl-6-phenyl-2-(2-phenylethyl)pyrimidin-5-yl]pentanoic acid.
| Compound Name | 2-[4-methyl-6-phenyl-2-(2-phenylethyl)pyrimidin-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 50997511 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-[4-methyl-6-phenyl-2-(2-phenylethyl)pyrimidin-5-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1c(C)nc(CCc2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C24H26N2O2/c1-3-10-20(24(27)28)22-17(2)25-21(16-15-18-11-6-4-7-12-18)26-23(22)19-13-8-5-9-14-19/h4-9,11-14,20H,3,10,15-16H2,1-2H3,(H,27,28) |
| InChIKey | CZSQTKLLJBSSBC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |