C24H27N3O2 — CID 66955986
2-[2-(benzylamino)-4-methyl-6-(4-methylphenyl)pyrimidin-5-yl]pentanoic acid (PubChem CID 66955986) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-[2-(benzylamino)-4-methyl-6-(4-methylphenyl)pyrimidin-5-yl]pentanoic acid.
| Compound Name | 2-[2-(benzylamino)-4-methyl-6-(4-methylphenyl)pyrimidin-5-yl]pentanoic acid |
|---|---|
| PubChem CID | 66955986 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 2-[2-(benzylamino)-4-methyl-6-(4-methylphenyl)pyrimidin-5-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)c1c(C)nc(NCc2ccccc2)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27N3O2/c1-4-8-20(23(28)29)21-17(3)26-24(25-15-18-9-6-5-7-10-18)27-22(21)19-13-11-16(2)12-14-19/h5-7,9-14,20H,4,8,15H2,1-3H3,(H,28,29)(H,25,26,27) |
| InChIKey | OOAUAJCDLJKBFB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |