C32H39N5O3 — CID 66959961
1-methyl-6-[3-[2-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]ethyl-(pyridin-4-ylmethyl)amino]propoxy]quinolin-2-one (PubChem CID 66959961) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is 1-methyl-6-[3-[2-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]ethyl-(pyridin-4-ylmethyl)amino]propoxy]quinolin-2-one.
| Compound Name | 1-methyl-6-[3-[2-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]ethyl-(pyridin-4-ylmethyl)amino]propoxy]quinolin-2-one |
|---|---|
| PubChem CID | 66959961 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 1-methyl-6-[3-[2-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]ethyl-(pyridin-4-ylmethyl)amino]propoxy]quinolin-2-one |
| SMILES | Cn1c(=O)ccc2cc(OCCCN(CCN3CCC(OCc4cccnc4)CC3)Cc3ccncc3)ccc21 |
| InChI | InChI=1S/C32H39N5O3/c1-35-31-7-6-30(22-28(31)5-8-32(35)38)39-21-3-16-37(24-26-9-14-33-15-10-26)20-19-36-17-11-29(12-18-36)40-25-27-4-2-13-34-23-27/h2,4-10,13-15,22-23,29H,3,11-12,16-21,24-25H2,1H3 |
| InChIKey | RRAWLMZVZYKTNV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|