C18H25NO5 — CID 66960507
[(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]methanone (PubChem CID 66960507) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]methanone.
| Compound Name | [(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]methanone |
|---|---|
| PubChem CID | 66960507 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | [(3S,4S)-3,4-dihydroxypyrrolidin-1-yl]-[4-(4,4,5,5-tetramethyl-1,3-dioxolan-2-yl)phenyl]methanone |
| SMILES | CC1(C)OC(c2ccc(C(=O)N3C[C@H](O)[C@@H](O)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C18H25NO5/c1-17(2)18(3,4)24-16(23-17)12-7-5-11(6-8-12)15(22)19-9-13(20)14(21)10-19/h5-8,13-14,16,20-21H,9-10H2,1-4H3/t13-,14-/m0/s1 |
| InChIKey | PZYJHUCJXHGOQE-KBPBESRZSA-N |
| XLogP | 1.47 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |