C21H32O13 — CID 66960668
(2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2,4-dimethoxyphenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 66960668) has the molecular formula C21H32O13 and a molecular weight of 492.47 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2,4-dimethoxyphenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2,4-dimethoxyphenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 66960668 |
| Molecular Formula | C21H32O13 |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(2R,3S,4S,5R,6S)-6-[(2,4-dimethoxyphenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COc1ccc(CO[C@H]2O[C@H](CO[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)c(OC)c1 |
| InChI | InChI=1S/C21H32O13/c1-29-10-4-3-9(11(5-10)30-2)7-31-20-19(28)17(26)15(24)13(34-20)8-32-21-18(27)16(25)14(23)12(6-22)33-21/h3-5,12-28H,6-8H2,1-2H3/t12-,13-,14-,15-,16+,17+,18-,19-,20+,21-/m1/s1 |
| InChIKey | IJSKBWDPEQHAJZ-JPMRKFKVSA-N |
| XLogP | -3.16 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | -3.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |