C5H6NNa2O3 — CID 66963072
CID 66963072 (PubChem CID 66963072) has the molecular formula C5H6NNa2O3 and a molecular weight of 174.09 g/mol.
| Compound Name | CID 66963072 |
|---|---|
| PubChem CID | 66963072 |
| Molecular Formula | C5H6NNa2O3 |
| Molecular Weight | 174.09 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | — |
| SMILES | O=C1CCC(C(=O)[O-])N1.[Na+].[Na] |
| InChI | InChI=1S/C5H7NO3.2Na/c7-4-2-1-3(6-4)5(8)9;;/h3H,1-2H2,(H,6,7)(H,8,9);;/q;;+1/p-1 |
| InChIKey | MOSGFIVHMBZNAB-UHFFFAOYSA-M |
| XLogP | -5.36 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.09 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |