C17H25N3O3 — CID 66967055
tert-butyl (E)-3-[6-amino-5-(morpholin-4-ylmethyl)-3-pyridinyl]prop-2-enoate (PubChem CID 66967055) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is tert-butyl (E)-3-[6-amino-5-(morpholin-4-ylmethyl)-3-pyridinyl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[6-amino-5-(morpholin-4-ylmethyl)-3-pyridinyl]prop-2-enoate |
|---|---|
| PubChem CID | 66967055 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | tert-butyl (E)-3-[6-amino-5-(morpholin-4-ylmethyl)-3-pyridinyl]prop-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C/c1cnc(N)c(CN2CCOCC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-17(2,3)23-15(21)5-4-13-10-14(16(18)19-11-13)12-20-6-8-22-9-7-20/h4-5,10-11H,6-9,12H2,1-3H3,(H2,18,19)/b5-4+ |
| InChIKey | JLPYALPAKZSWJG-SNAWJCMRSA-N |
| XLogP | 1.85 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|