C15H22N4O3 — CID 66966503
(E)-3-[6-amino-5-[(2-morpholin-4-ylethylamino)methyl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 66966503) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (E)-3-[6-amino-5-[(2-morpholin-4-ylethylamino)methyl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-amino-5-[(2-morpholin-4-ylethylamino)methyl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66966503 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (E)-3-[6-amino-5-[(2-morpholin-4-ylethylamino)methyl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | Nc1ncc(/C=C/C(=O)O)cc1CNCCN1CCOCC1 |
| InChI | InChI=1S/C15H22N4O3/c16-15-13(9-12(10-18-15)1-2-14(20)21)11-17-3-4-19-5-7-22-8-6-19/h1-2,9-10,17H,3-8,11H2,(H2,16,18)(H,20,21)/b2-1+ |
| InChIKey | UWTNIGNUHCATLR-OWOJBTEDSA-N |
| XLogP | 0.18 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|