About 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide
2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide (PubChem CID 66968044) has the molecular formula C15H14BrFN2O2
and a molecular weight of 353.19 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide |
| PubChem CID | 66968044 |
| Molecular Formula | C15H14BrFN2O2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)Nc1cc(C2(CF)CC2)on1 |
| InChI | InChI=1S/C15H14BrFN2O2/c16-11-3-1-10(2-4-11)7-14(20)18-13-8-12(21-19-13)15(9-17)5-6-15/h1-4,8H,5-7,9H2,(H,18,19,20) |
| InChIKey | ITFDNUUGDSZILX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide?
The IUPAC name of 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide (CID 66968044) is 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide.
What is the SMILES notation for 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide?
The canonical SMILES for 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide is O=C(Cc1ccc(Br)cc1)Nc1cc(C2(CF)CC2)on1.
What is the InChIKey of 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide?
The InChIKey is ITFDNUUGDSZILX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14BrFN2O2/c16-11-3-1-10(2-4-11)7-14(20)18-13-8-12(21-19-13)15(9-17)5-6-15/h1-4,8H,5-7,9H2,(H,18,19,20).
What are the key properties of 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide?
2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide has a molecular weight of 353.19 g/mol, XLogP of 3.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-N-[5-[1-(fluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]acetamide is sourced from PubChem (CID 66968044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).