C21H25BF2N2O4 — CID 66968294
N-[5-[1-(difluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (PubChem CID 66968294) has the molecular formula C21H25BF2N2O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is N-[5-[1-(difluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide.
| Compound Name | N-[5-[1-(difluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 66968294 |
| Molecular Formula | C21H25BF2N2O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[5-[1-(difluoromethyl)cyclopropyl]-1,2-oxazol-3-yl]-2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| SMILES | CC1(C)OB(c2ccc(CC(=O)Nc3cc(C4(C(F)F)CC4)on3)cc2)OC1(C)C |
| InChI | InChI=1S/C21H25BF2N2O4/c1-19(2)20(3,4)30-22(29-19)14-7-5-13(6-8-14)11-17(27)25-16-12-15(28-26-16)21(9-10-21)18(23)24/h5-8,12,18H,9-11H2,1-4H3,(H,25,26,27) |
| InChIKey | OMGDWIREUOBNSQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|