C19H26N4O4 — CID 66968423
3-[3-amino-2-(2-aminopropanoylamino)-3-oxopropyl]-2-tert-butylindole-1-carboxylic acid (PubChem CID 66968423) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-[3-amino-2-(2-aminopropanoylamino)-3-oxopropyl]-2-tert-butylindole-1-carboxylic acid.
| Compound Name | 3-[3-amino-2-(2-aminopropanoylamino)-3-oxopropyl]-2-tert-butylindole-1-carboxylic acid |
|---|---|
| PubChem CID | 66968423 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 3-[3-amino-2-(2-aminopropanoylamino)-3-oxopropyl]-2-tert-butylindole-1-carboxylic acid |
| SMILES | CC(N)C(=O)NC(Cc1c(C(C)(C)C)n(C(=O)O)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C19H26N4O4/c1-10(20)17(25)22-13(16(21)24)9-12-11-7-5-6-8-14(11)23(18(26)27)15(12)19(2,3)4/h5-8,10,13H,9,20H2,1-4H3,(H2,21,24)(H,22,25)(H,26,27) |
| InChIKey | DPYJCVMTRXQDLN-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |