C26H30N6O3S — CID 66970927
6-[[[2-(2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl)-1-[(3S)-piperidin-3-yl]ethyl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one (PubChem CID 66970927) has the molecular formula C26H30N6O3S and a molecular weight of 506.63 g/mol. Its IUPAC name is 6-[[[2-(2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl)-1-[(3S)-piperidin-3-yl]ethyl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one.
| Compound Name | 6-[[[2-(2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl)-1-[(3S)-piperidin-3-yl]ethyl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
|---|---|
| PubChem CID | 66970927 |
| Molecular Formula | C26H30N6O3S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | 6-[[[2-(2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl)-1-[(3S)-piperidin-3-yl]ethyl]amino]methyl]-4H-pyrido[3,2-b][1,4]thiazin-3-one |
| SMILES | COc1ccc2ncc3c(c2n1)C(CC(NCc1ccc2c(n1)NC(=O)CS2)[C@H]1CCCNC1)CO3 |
| InChI | InChI=1S/C26H30N6O3S/c1-34-23-7-5-18-25(32-23)24-16(13-35-20(24)12-29-18)9-19(15-3-2-8-27-10-15)28-11-17-4-6-21-26(30-17)31-22(33)14-36-21/h4-7,12,15-16,19,27-28H,2-3,8-11,13-14H2,1H3,(H,30,31,33)/t15-,16?,19?/m0/s1 |
| InChIKey | SAYKBRSGRZMNLT-LYGPFTKASA-N |
| XLogP | 3.10 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |