C23H22N4O2 — CID 66971371
1-benzyl-3-[4-(3,3-dimethyl-2-oxoindol-1-yl)-2-pyridinyl]urea (PubChem CID 66971371) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-benzyl-3-[4-(3,3-dimethyl-2-oxoindol-1-yl)-2-pyridinyl]urea.
| Compound Name | 1-benzyl-3-[4-(3,3-dimethyl-2-oxoindol-1-yl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 66971371 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-benzyl-3-[4-(3,3-dimethyl-2-oxoindol-1-yl)-2-pyridinyl]urea |
| SMILES | CC1(C)C(=O)N(c2ccnc(NC(=O)NCc3ccccc3)c2)c2ccccc21 |
| InChI | InChI=1S/C23H22N4O2/c1-23(2)18-10-6-7-11-19(18)27(21(23)28)17-12-13-24-20(14-17)26-22(29)25-15-16-8-4-3-5-9-16/h3-14H,15H2,1-2H3,(H2,24,25,26,29) |
| InChIKey | BFOZWKQWTJIJNQ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |